ChemNet > CAS > 465514-69-6 3-[2-(3-chlorofenylo)acetylo]benzonitryl
465514-69-6 3-[2-(3-chlorofenylo)acetylo]benzonitryl
| Nazwa produktu: |
3-[2-(3-chlorofenylo)acetylo]benzonitryl |
| Synonimy |
3-[(3-chlorofenylo)acetylo]benzonitryl |
| Angielska nazwa |
3-[2-(3-chlorophenyl)acetyl]benzonitrile;3-[(3-chlorophenyl)acetyl]benzonitrile |
| MF |
C15H10ClNO |
| Masie cząsteczkowej |
255.699 |
| InChI |
InChI=1/C15H10ClNO/c16-14-6-2-3-11(8-14)9-15(18)13-5-1-4-12(7-13)10-17/h1-8H,9H2 |
| Nr CAS |
465514-69-6 |
| Struktury molekularnej |
![465514-69-6 3-[2-(3-chlorofenylo)acetylo]benzonitryl](https://images-a.chemnet.com/suppliers/chembase/849/116849.gif)
|
| Gęstość |
1.27g/cm3 |
| Temperatura topnienia |
87.5℃ |
| Temperatura wrzenia |
416.5°C at 760 mmHg |
| Współczynnik załamania |
1.615 |
| Temperatura zapłonu |
205.7°C |
| Ciśnienie pary |
3.81E-07mmHg at 25°C |
| Symbole zagrożenia |
 Xn:Harmful;
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|
